C15H16O3 — CID 16742342
ethyl 2-but-3-enyl-1-benzofuran-3-carboxylate (PubChem CID 16742342) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is ethyl 2-but-3-enyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-but-3-enyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 16742342 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | ethyl 2-but-3-enyl-1-benzofuran-3-carboxylate |
| SMILES | C=CCCc1oc2ccccc2c1C(=O)OCC |
| InChI | InChI=1S/C15H16O3/c1-3-5-9-13-14(15(16)17-4-2)11-8-6-7-10-12(11)18-13/h3,6-8,10H,1,4-5,9H2,2H3 |
| InChIKey | VTUIQHXBDCELCD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|