C21H26N2O4 — CID 100856227
ethyl 2-[[(2S,3aS,7aS)-2-carbamoyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methyl]-1-benzofuran-3-carboxylate (PubChem CID 100856227) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl 2-[[(2S,3aS,7aS)-2-carbamoyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methyl]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-[[(2S,3aS,7aS)-2-carbamoyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methyl]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 100856227 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | ethyl 2-[[(2S,3aS,7aS)-2-carbamoyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methyl]-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2[C@H](C(N)=O)C[C@@H]3CCCC[C@@H]32)oc2ccccc12 |
| InChI | InChI=1S/C21H26N2O4/c1-2-26-21(25)19-14-8-4-6-10-17(14)27-18(19)12-23-15-9-5-3-7-13(15)11-16(23)20(22)24/h4,6,8,10,13,15-16H,2-3,5,7,9,11-12H2,1H3,(H2,22,24)/t13-,15-,16-/m0/s1 |
| InChIKey | GHTGJDYZAAJRLB-BPUTZDHNSA-N |
| XLogP | 3.23 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |