C18H23NO4 — CID 49230182
ethyl 2-[[4-(hydroxymethyl)piperidin-1-yl]methyl]-1-benzofuran-3-carboxylate (PubChem CID 49230182) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is ethyl 2-[[4-(hydroxymethyl)piperidin-1-yl]methyl]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-[[4-(hydroxymethyl)piperidin-1-yl]methyl]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 49230182 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | ethyl 2-[[4-(hydroxymethyl)piperidin-1-yl]methyl]-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCC(CO)CC2)oc2ccccc12 |
| InChI | InChI=1S/C18H23NO4/c1-2-22-18(21)17-14-5-3-4-6-15(14)23-16(17)11-19-9-7-13(12-20)8-10-19/h3-6,13,20H,2,7-12H2,1H3 |
| InChIKey | JLSXRLQHESGRBE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |