C22H29N3O5 — CID 49229636
ethyl 2-[[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]methyl]-1-benzofuran-3-carboxylate (PubChem CID 49229636) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl 2-[[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]methyl]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-[[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]methyl]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 49229636 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | ethyl 2-[[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]methyl]-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCN(C(=O)CN3CCOCC3)CC2)oc2ccccc12 |
| InChI | InChI=1S/C22H29N3O5/c1-2-29-22(27)21-17-5-3-4-6-18(17)30-19(21)15-23-7-9-25(10-8-23)20(26)16-24-11-13-28-14-12-24/h3-6H,2,7-16H2,1H3 |
| InChIKey | QJAIEIYRLMPYEU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |