C18H23ClNO4- — CID 53313482
ethyl 5-methoxy-2-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxylate chloride (PubChem CID 53313482) has the molecular formula C18H23ClNO4- and a molecular weight of 352.84 g/mol. Its IUPAC name is ethyl 5-methoxy-2-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxylate chloride.
| Compound Name | ethyl 5-methoxy-2-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxylate chloride |
|---|---|
| PubChem CID | 53313482 |
| Molecular Formula | C18H23ClNO4- |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | ethyl 5-methoxy-2-(piperidin-1-ylmethyl)-1-benzofuran-3-carboxylate chloride |
| SMILES | CCOC(=O)c1c(CN2CCCCC2)oc2ccc(OC)cc12.[Cl-] |
| InChI | InChI=1S/C18H23NO4.ClH/c1-3-22-18(20)17-14-11-13(21-2)7-8-15(14)23-16(17)12-19-9-5-4-6-10-19;/h7-8,11H,3-6,9-10,12H2,1-2H3;1H/p-1 |
| InChIKey | HGZSBQVMILARPH-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |