C14H17BrN2O4S — CID 131882913
ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide (PubChem CID 131882913) has the molecular formula C14H17BrN2O4S and a molecular weight of 389.27 g/mol. Its IUPAC name is ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide.
| Compound Name | ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 131882913 |
| Molecular Formula | C14H17BrN2O4S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)c1c(CNC(N)=S)oc2ccc(OC)cc12 |
| InChI | InChI=1S/C14H16N2O4S.BrH/c1-3-19-13(17)12-9-6-8(18-2)4-5-10(9)20-11(12)7-16-14(15)21;/h4-6H,3,7H2,1-2H3,(H3,15,16,21);1H |
| InChIKey | FIYQFPDHPIRPPA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|