About ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide
ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide (PubChem CID 131882913) has the molecular formula C14H17BrN2O4S
and a molecular weight of 389.27 g/mol. Its IUPAC name is ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide.
Molecular Properties
| Compound Name | ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide |
| PubChem CID | 131882913 |
| Molecular Formula | C14H17BrN2O4S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)c1c(CNC(N)=S)oc2ccc(OC)cc12 |
| InChI | InChI=1S/C14H16N2O4S.BrH/c1-3-19-13(17)12-9-6-8(18-2)4-5-10(9)20-11(12)7-16-14(15)21;/h4-6H,3,7H2,1-2H3,(H3,15,16,21);1H |
| InChIKey | FIYQFPDHPIRPPA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide?
The IUPAC name of ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide (CID 131882913) is ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide.
What is the SMILES notation for ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide?
The canonical SMILES for ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide is Br.CCOC(=O)c1c(CNC(N)=S)oc2ccc(OC)cc12.
What is the InChIKey of ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide?
The InChIKey is FIYQFPDHPIRPPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4S.BrH/c1-3-19-13(17)12-9-6-8(18-2)4-5-10(9)20-11(12)7-16-14(15)21;/h4-6H,3,7H2,1-2H3,(H3,15,16,21);1H.
What are the key properties of ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide?
ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide has a molecular weight of 389.27 g/mol, XLogP of 2.53, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(carbamothioylamino)methyl]-5-methoxy-1-benzofuran-3-carboxylate;hydrobromide is sourced from PubChem (CID 131882913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).