C14H16O4 — CID 131696400
5-methoxy-2-(2-methylpropyl)-1-benzofuran-3-carboxylic acid (PubChem CID 131696400) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-methoxy-2-(2-methylpropyl)-1-benzofuran-3-carboxylic acid.
| Compound Name | 5-methoxy-2-(2-methylpropyl)-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 131696400 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-methoxy-2-(2-methylpropyl)-1-benzofuran-3-carboxylic acid |
| SMILES | COc1ccc2oc(CC(C)C)c(C(=O)O)c2c1 |
| InChI | InChI=1S/C14H16O4/c1-8(2)6-12-13(14(15)16)10-7-9(17-3)4-5-11(10)18-12/h4-5,7-8H,6H2,1-3H3,(H,15,16) |
| InChIKey | YLKPFDKIFZQMSN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |