C14H18ClNO4 — CID 44659997
(3-ethoxycarbonyl-5-hydroxy-1-benzofuran-2-yl)methyl-dimethylazanium chloride (PubChem CID 44659997) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is (3-ethoxycarbonyl-5-hydroxy-1-benzofuran-2-yl)methyl-dimethylazanium chloride.
| Compound Name | (3-ethoxycarbonyl-5-hydroxy-1-benzofuran-2-yl)methyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 44659997 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (3-ethoxycarbonyl-5-hydroxy-1-benzofuran-2-yl)methyl-dimethylazanium chloride |
| SMILES | CCOC(=O)c1c(C[NH+](C)C)oc2ccc(O)cc12.[Cl-] |
| InChI | InChI=1S/C14H17NO4.ClH/c1-4-18-14(17)13-10-7-9(16)5-6-11(10)19-12(13)8-15(2)3;/h5-7,16H,4,8H2,1-3H3;1H |
| InChIKey | LKMCSDXABKTLJF-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |