C11H12Cl2O4 — CID 15720288
ethyl 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate (PubChem CID 15720288) has the molecular formula C11H12Cl2O4 and a molecular weight of 279.12 g/mol. Its IUPAC name is ethyl 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate.
| Compound Name | ethyl 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate |
|---|---|
| PubChem CID | 15720288 |
| Molecular Formula | C11H12Cl2O4 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | ethyl 3,5-dichloro-2-ethyl-4,6-dihydroxybenzoate |
| SMILES | CCOC(=O)c1c(O)c(Cl)c(O)c(Cl)c1CC |
| InChI | InChI=1S/C11H12Cl2O4/c1-3-5-6(11(16)17-4-2)9(14)8(13)10(15)7(5)12/h14-15H,3-4H2,1-2H3 |
| InChIKey | WPMPMHXPDZOTEY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |