C10H12Cl2N3OS+ — CID 135781345
carbamothioyl-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-dimethylazanium (PubChem CID 135781345) has the molecular formula C10H12Cl2N3OS+ and a molecular weight of 293.20 g/mol. Its IUPAC name is carbamothioyl-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-dimethylazanium.
| Compound Name | carbamothioyl-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-dimethylazanium |
|---|---|
| PubChem CID | 135781345 |
| Molecular Formula | C10H12Cl2N3OS+ |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | carbamothioyl-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-dimethylazanium |
| SMILES | C[N+](C)(/N=C/c1cc(Cl)cc(Cl)c1O)C(N)=S |
| InChI | InChI=1S/C10H11Cl2N3OS/c1-15(2,10(13)17)14-5-6-3-7(11)4-8(12)9(6)16/h3-5H,1-2H3,(H2-,13,14,16,17)/p+1 |
| InChIKey | STRCJSZOMLKLQX-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|