C16H16INO2 — CID 171980248
2-[(2-hydroxy-4,5-dimethylphenyl)iminomethyl]-6-iodo-4-methylphenol (PubChem CID 171980248) has the molecular formula C16H16INO2 and a molecular weight of 381.21 g/mol. Its IUPAC name is 2-[(2-hydroxy-4,5-dimethylphenyl)iminomethyl]-6-iodo-4-methylphenol.
| Compound Name | 2-[(2-hydroxy-4,5-dimethylphenyl)iminomethyl]-6-iodo-4-methylphenol |
|---|---|
| PubChem CID | 171980248 |
| Molecular Formula | C16H16INO2 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-[(2-hydroxy-4,5-dimethylphenyl)iminomethyl]-6-iodo-4-methylphenol |
| SMILES | Cc1cc(I)c(O)c(/C=N/c2cc(C)c(C)cc2O)c1 |
| InChI | InChI=1S/C16H16INO2/c1-9-4-12(16(20)13(17)5-9)8-18-14-6-10(2)11(3)7-15(14)19/h4-8,19-20H,1-3H3/b18-8+ |
| InChIKey | YEYWNZFRYGVROT-QGMBQPNBSA-N |
| XLogP | 4.38 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|