C19H20Cl2N2O3S — CID 1015011
N-cyclohexyl-4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 1015011) has the molecular formula C19H20Cl2N2O3S and a molecular weight of 427.35 g/mol. Its IUPAC name is N-cyclohexyl-4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | N-cyclohexyl-4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 1015011 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-cyclohexyl-4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1)c1ccc(/N=C/c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C19H20Cl2N2O3S/c20-14-10-13(19(24)18(21)11-14)12-22-15-6-8-17(9-7-15)27(25,26)23-16-4-2-1-3-5-16/h6-12,16,23-24H,1-5H2/b22-12+ |
| InChIKey | XUFFUKKRWSPSCD-WSDLNYQXSA-N |
| XLogP | 5.06 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|