C26H16Cl4N2O2S — CID 3091569
1-(2,4-dichlorophenyl)-N-[4-[4-[(2,4-dichlorophenyl)methylideneamino]phenyl]sulfonylphenyl]methanimine (PubChem CID 3091569) has the molecular formula C26H16Cl4N2O2S and a molecular weight of 562.31 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[4-[4-[(2,4-dichlorophenyl)methylideneamino]phenyl]sulfonylphenyl]methanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[4-[4-[(2,4-dichlorophenyl)methylideneamino]phenyl]sulfonylphenyl]methanimine |
|---|---|
| PubChem CID | 3091569 |
| Molecular Formula | C26H16Cl4N2O2S |
| Molecular Weight | 562.31 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[4-[4-[(2,4-dichlorophenyl)methylideneamino]phenyl]sulfonylphenyl]methanimine |
| SMILES | O=S(=O)(c1ccc(/N=C/c2ccc(Cl)cc2Cl)cc1)c1ccc(/N=C/c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C26H16Cl4N2O2S/c27-19-3-1-17(25(29)13-19)15-31-21-5-9-23(10-6-21)35(33,34)24-11-7-22(8-12-24)32-16-18-2-4-20(28)14-26(18)30/h1-16H/b31-15+,32-16+ |
| InChIKey | BEPVJIBHXRZYAZ-IHXWQEJPSA-N |
| XLogP | 8.63 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.31 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|