C18H13Cl2N3O2S — CID 28589307
4-[(2,4-dichlorophenyl)methylideneamino]-N-pyridin-3-ylbenzenesulfonamide (PubChem CID 28589307) has the molecular formula C18H13Cl2N3O2S and a molecular weight of 406.29 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methylideneamino]-N-pyridin-3-ylbenzenesulfonamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methylideneamino]-N-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 28589307 |
| Molecular Formula | C18H13Cl2N3O2S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methylideneamino]-N-pyridin-3-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccnc1)c1ccc(/N=C/c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H13Cl2N3O2S/c19-14-4-3-13(18(20)10-14)11-22-15-5-7-17(8-6-15)26(24,25)23-16-2-1-9-21-12-16/h1-12,23H/b22-11+ |
| InChIKey | QEPGXJSKWDKDPC-SSDVNMTOSA-N |
| XLogP | 4.94 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|