C11H8Cl2N2O2S — CID 890470
2,6-dichloro-N-pyridin-3-ylbenzenesulfonamide (PubChem CID 890470) has the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.17 g/mol. Its IUPAC name is 2,6-dichloro-N-pyridin-3-ylbenzenesulfonamide.
| Compound Name | 2,6-dichloro-N-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 890470 |
| Molecular Formula | C11H8Cl2N2O2S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 2,6-dichloro-N-pyridin-3-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccnc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H8Cl2N2O2S/c12-9-4-1-5-10(13)11(9)18(16,17)15-8-3-2-6-14-7-8/h1-7,15H |
| InChIKey | MNTNSXGAJQLXPT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |