C20H19N3O4S — CID 28589297
4-[(2,3-dimethoxyphenyl)methylideneamino]-N-pyridin-3-ylbenzenesulfonamide (PubChem CID 28589297) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 4-[(2,3-dimethoxyphenyl)methylideneamino]-N-pyridin-3-ylbenzenesulfonamide.
| Compound Name | 4-[(2,3-dimethoxyphenyl)methylideneamino]-N-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 28589297 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-[(2,3-dimethoxyphenyl)methylideneamino]-N-pyridin-3-ylbenzenesulfonamide |
| SMILES | COc1cccc(/C=N/c2ccc(S(=O)(=O)Nc3cccnc3)cc2)c1OC |
| InChI | InChI=1S/C20H19N3O4S/c1-26-19-7-3-5-15(20(19)27-2)13-22-16-8-10-18(11-9-16)28(24,25)23-17-6-4-12-21-14-17/h3-14,23H,1-2H3/b22-13+ |
| InChIKey | GFKZRNQTYMUQLI-LPYMAVHISA-N |
| XLogP | 3.65 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|