C20H19N3O5S — CID 28578712
2,6-dimethoxy-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide (PubChem CID 28578712) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28578712 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2,6-dimethoxy-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(S(=O)(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C20H19N3O5S/c1-27-17-6-3-7-18(28-2)19(17)20(24)22-14-8-10-16(11-9-14)29(25,26)23-15-5-4-12-21-13-15/h3-13,23H,1-2H3,(H,22,24) |
| InChIKey | GOCCXBJJFGHJDU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |