C23H24N4O7S2 — CID 43876086
2-methoxy-5-morpholin-4-ylsulfonyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide (PubChem CID 43876086) has the molecular formula C23H24N4O7S2 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-methoxy-5-morpholin-4-ylsulfonyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-methoxy-5-morpholin-4-ylsulfonyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43876086 |
| Molecular Formula | C23H24N4O7S2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 2-methoxy-5-morpholin-4-ylsulfonyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)Nc1ccc(S(=O)(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C23H24N4O7S2/c1-33-22-9-8-20(36(31,32)27-11-13-34-14-12-27)15-21(22)23(28)25-17-4-6-19(7-5-17)35(29,30)26-18-3-2-10-24-16-18/h2-10,15-16,26H,11-14H2,1H3,(H,25,28) |
| InChIKey | RWGPMUXCAIIGBA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |