C16H18N2O5S — CID 1275154
4-[(2,3,4-trimethoxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 1275154) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-[(2,3,4-trimethoxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-[(2,3,4-trimethoxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 1275154 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-[(2,3,4-trimethoxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(/C=N/c2ccc(S(N)(=O)=O)cc2)c(OC)c1OC |
| InChI | InChI=1S/C16H18N2O5S/c1-21-14-9-4-11(15(22-2)16(14)23-3)10-18-12-5-7-13(8-6-12)24(17,19)20/h4-10H,1-3H3,(H2,17,19,20)/b18-10+ |
| InChIKey | OTLIOOQJKLRFSP-VCHYOVAHSA-N |
| XLogP | 2.11 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|