C19H20N2O5S2 — CID 5198092
[2-methoxy-4-[(4-sulfamoylphenyl)iminomethyl]phenyl] 2-prop-2-enylsulfanylacetate (PubChem CID 5198092) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is [2-methoxy-4-[(4-sulfamoylphenyl)iminomethyl]phenyl] 2-prop-2-enylsulfanylacetate.
| Compound Name | [2-methoxy-4-[(4-sulfamoylphenyl)iminomethyl]phenyl] 2-prop-2-enylsulfanylacetate |
|---|---|
| PubChem CID | 5198092 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | [2-methoxy-4-[(4-sulfamoylphenyl)iminomethyl]phenyl] 2-prop-2-enylsulfanylacetate |
| SMILES | C=CCSCC(=O)Oc1ccc(/C=N/c2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C19H20N2O5S2/c1-3-10-27-13-19(22)26-17-9-4-14(11-18(17)25-2)12-21-15-5-7-16(8-6-15)28(20,23)24/h3-9,11-12H,1,10,13H2,2H3,(H2,20,23,24)/b21-12+ |
| InChIKey | HUSPJGUADHTQBW-CIAFOILYSA-N |
| XLogP | 2.92 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|