C22H26Cl2N2O3 — CID 3046143
[4-[(4-chlorophenyl)iminomethyl]-2-methoxyphenyl] 2-(3-methylpiperidin-1-yl)acetate;hydrochloride (PubChem CID 3046143) has the molecular formula C22H26Cl2N2O3 and a molecular weight of 437.37 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)iminomethyl]-2-methoxyphenyl] 2-(3-methylpiperidin-1-yl)acetate;hydrochloride.
| Compound Name | [4-[(4-chlorophenyl)iminomethyl]-2-methoxyphenyl] 2-(3-methylpiperidin-1-yl)acetate;hydrochloride |
|---|---|
| PubChem CID | 3046143 |
| Molecular Formula | C22H26Cl2N2O3 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [4-[(4-chlorophenyl)iminomethyl]-2-methoxyphenyl] 2-(3-methylpiperidin-1-yl)acetate;hydrochloride |
| SMILES | COc1cc(/C=N/c2ccc(Cl)cc2)ccc1OC(=O)CN1CCCC(C)C1.Cl |
| InChI | InChI=1S/C22H25ClN2O3.ClH/c1-16-4-3-11-25(14-16)15-22(26)28-20-10-5-17(12-21(20)27-2)13-24-19-8-6-18(23)7-9-19;/h5-10,12-13,16H,3-4,11,14-15H2,1-2H3;1H/b24-13+; |
| InChIKey | OKIWLEQVSRXSHI-KEJAMGHHSA-N |
| XLogP | 5.16 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|