C19H13Cl2FN2O3S — CID 1272124
4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-N-(4-fluorophenyl)benzenesulfonamide (PubChem CID 1272124) has the molecular formula C19H13Cl2FN2O3S and a molecular weight of 439.30 g/mol. Its IUPAC name is 4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-N-(4-fluorophenyl)benzenesulfonamide.
| Compound Name | 4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-N-(4-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1272124 |
| Molecular Formula | C19H13Cl2FN2O3S |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-N-(4-fluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cc1)c1ccc(/N=C/c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C19H13Cl2FN2O3S/c20-13-9-12(19(25)18(21)10-13)11-23-15-5-7-17(8-6-15)28(26,27)24-16-3-1-14(22)2-4-16/h1-11,24-25H/b23-11+ |
| InChIKey | NKXLXDMUXLHWPW-FOKLQQMPSA-N |
| XLogP | 5.39 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|