C20H14Cl2N2O3 — CID 2725439
N-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]-2-hydroxybenzamide (PubChem CID 2725439) has the molecular formula C20H14Cl2N2O3 and a molecular weight of 401.25 g/mol. Its IUPAC name is N-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]-2-hydroxybenzamide.
| Compound Name | N-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 2725439 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(/N=C/c2cc(Cl)cc(Cl)c2O)cc1)c1ccccc1O |
| InChI | InChI=1S/C20H14Cl2N2O3/c21-13-9-12(19(26)17(22)10-13)11-23-14-5-7-15(8-6-14)24-20(27)16-3-1-2-4-18(16)25/h1-11,25-26H,(H,24,27)/b23-11+ |
| InChIKey | UCXZOSZVOVDYMR-FOKLQQMPSA-N |
| XLogP | 5.41 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|