C25H17Cl3N6O3 — CID 5210742
N'-[4-chloro-6-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]anilino]pyrimidin-5-yl]-N-phenyloxamide (PubChem CID 5210742) has the molecular formula C25H17Cl3N6O3 and a molecular weight of 555.81 g/mol. Its IUPAC name is N'-[4-chloro-6-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]anilino]pyrimidin-5-yl]-N-phenyloxamide.
| Compound Name | N'-[4-chloro-6-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]anilino]pyrimidin-5-yl]-N-phenyloxamide |
|---|---|
| PubChem CID | 5210742 |
| Molecular Formula | C25H17Cl3N6O3 |
| Molecular Weight | 555.81 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | N'-[4-chloro-6-[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]anilino]pyrimidin-5-yl]-N-phenyloxamide |
| SMILES | O=C(Nc1ccccc1)C(=O)Nc1c(Cl)ncnc1Nc1ccc(/N=C/c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C25H17Cl3N6O3/c26-15-10-14(21(35)19(27)11-15)12-29-16-6-8-18(9-7-16)32-23-20(22(28)30-13-31-23)34-25(37)24(36)33-17-4-2-1-3-5-17/h1-13,35H,(H,33,36)(H,34,37)(H,30,31,32)/b29-12+ |
| InChIKey | DLCJJXSTEKHYSJ-XKJRVUDJSA-N |
| XLogP | 6.21 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.81 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|