C16H14BrClN2O2 — CID 4054098
N-[4-[(5-bromo-3-chloro-2-hydroxyphenyl)methylideneamino]phenyl]propanamide (PubChem CID 4054098) has the molecular formula C16H14BrClN2O2 and a molecular weight of 381.66 g/mol. Its IUPAC name is N-[4-[(5-bromo-3-chloro-2-hydroxyphenyl)methylideneamino]phenyl]propanamide.
| Compound Name | N-[4-[(5-bromo-3-chloro-2-hydroxyphenyl)methylideneamino]phenyl]propanamide |
|---|---|
| PubChem CID | 4054098 |
| Molecular Formula | C16H14BrClN2O2 |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | N-[4-[(5-bromo-3-chloro-2-hydroxyphenyl)methylideneamino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(/N=C/c2cc(Br)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C16H14BrClN2O2/c1-2-15(21)20-13-5-3-12(4-6-13)19-9-10-7-11(17)8-14(18)16(10)22/h3-9,22H,2H2,1H3,(H,20,21)/b19-9+ |
| InChIKey | LRMKCXIYPNGWLC-DJKKODMXSA-N |
| XLogP | 4.91 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|