C21H14Cl2N2O3 — CID 20725290
2-(3,5-dichloro-4-hydroxyphenyl)imino-3-oxo-N,3-diphenylpropanamide (PubChem CID 20725290) has the molecular formula C21H14Cl2N2O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-hydroxyphenyl)imino-3-oxo-N,3-diphenylpropanamide.
| Compound Name | 2-(3,5-dichloro-4-hydroxyphenyl)imino-3-oxo-N,3-diphenylpropanamide |
|---|---|
| PubChem CID | 20725290 |
| Molecular Formula | C21H14Cl2N2O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 2-(3,5-dichloro-4-hydroxyphenyl)imino-3-oxo-N,3-diphenylpropanamide |
| SMILES | O=C(Nc1ccccc1)/C(=N/c1cc(Cl)c(O)c(Cl)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H14Cl2N2O3/c22-16-11-15(12-17(23)20(16)27)24-18(19(26)13-7-3-1-4-8-13)21(28)25-14-9-5-2-6-10-14/h1-12,27H,(H,25,28)/b24-18+ |
| InChIKey | UTZDHBMQTVMOOY-HKOYGPOVSA-N |
| XLogP | 5.29 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|