C10H10N3O3- — CID 135764917
(2Z,3E)-2-hydroxyimino-3-oxidoimino-N-phenylbutanamide (PubChem CID 135764917) has the molecular formula C10H10N3O3- and a molecular weight of 220.21 g/mol. Its IUPAC name is (2Z,3E)-2-hydroxyimino-3-oxidoimino-N-phenylbutanamide.
| Compound Name | (2Z,3E)-2-hydroxyimino-3-oxidoimino-N-phenylbutanamide |
|---|---|
| PubChem CID | 135764917 |
| Molecular Formula | C10H10N3O3- |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (2Z,3E)-2-hydroxyimino-3-oxidoimino-N-phenylbutanamide |
| SMILES | CC(=N\[O-])/C(=N/O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H11N3O3/c1-7(12-15)9(13-16)10(14)11-8-5-3-2-4-6-8/h2-6,15-16H,1H3,(H,11,14)/p-1/b12-7+,13-9- |
| InChIKey | LTVZTEPROUYMGF-QOZIKOCUSA-M |
| XLogP | 1.41 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|