C20H20N6NiO6 — CID 170850552
2,3-bis(hydroxyimino)-N-phenylbutanamide;2,3-bis(oxidoimino)-N-phenylbutanamide;nickel(2+) (PubChem CID 170850552) has the molecular formula C20H20N6NiO6 and a molecular weight of 499.11 g/mol. Its IUPAC name is 2,3-bis(hydroxyimino)-N-phenylbutanamide;2,3-bis(oxidoimino)-N-phenylbutanamide;nickel(2+).
| Compound Name | 2,3-bis(hydroxyimino)-N-phenylbutanamide;2,3-bis(oxidoimino)-N-phenylbutanamide;nickel(2+) |
|---|---|
| PubChem CID | 170850552 |
| Molecular Formula | C20H20N6NiO6 |
| Molecular Weight | 499.11 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 2,3-bis(hydroxyimino)-N-phenylbutanamide;2,3-bis(oxidoimino)-N-phenylbutanamide;nickel(2+) |
| SMILES | CC(=NO)C(=NO)C(=O)Nc1ccccc1.CC(=N[O-])C(=N[O-])C(=O)Nc1ccccc1.[Ni+2] |
| InChI | InChI=1S/2C10H11N3O3.Ni/c2*1-7(12-15)9(13-16)10(14)11-8-5-3-2-4-6-8;/h2*2-6,15-16H,1H3,(H,11,14);/q;;+2/p-2 |
| InChIKey | OLXUNAUDZFVIET-UHFFFAOYSA-L |
| XLogP | 2.83 |
| TPSA | 194.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.11 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|