C15H9Cl2NO2 — CID 82885550
N-(3,5-dichloro-4-hydroxyphenyl)-3-phenylprop-2-ynamide (PubChem CID 82885550) has the molecular formula C15H9Cl2NO2 and a molecular weight of 306.15 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-3-phenylprop-2-ynamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-3-phenylprop-2-ynamide |
|---|---|
| PubChem CID | 82885550 |
| Molecular Formula | C15H9Cl2NO2 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-3-phenylprop-2-ynamide |
| SMILES | O=C(C#Cc1ccccc1)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2NO2/c16-12-8-11(9-13(17)15(12)20)18-14(19)7-6-10-4-2-1-3-5-10/h1-5,8-9,20H,(H,18,19) |
| InChIKey | XGGABAGPTAOJGT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|