C28H18Cl4CoN4O6 — CID 5386751
cobalt(2+);bis(2,4-dichloro-6-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenolate) (PubChem CID 5386751) has the molecular formula C28H18Cl4CoN4O6 and a molecular weight of 707.22 g/mol. Its IUPAC name is cobalt(2+);bis(2,4-dichloro-6-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenolate).
| Compound Name | cobalt(2+);bis(2,4-dichloro-6-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenolate) |
|---|---|
| PubChem CID | 5386751 |
| Molecular Formula | C28H18Cl4CoN4O6 |
| Molecular Weight | 707.22 g/mol |
| Exact Mass | 704.93 |
| IUPAC Name | cobalt(2+);bis(2,4-dichloro-6-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenolate) |
| SMILES | O=C(N/N=C/c1cc(Cl)cc(Cl)c1[O-])c1ccccc1O.O=C(N/N=C/c1cc(Cl)cc(Cl)c1[O-])c1ccccc1O.[Co+2] |
| InChI | InChI=1S/2C14H10Cl2N2O3.Co/c2*15-9-5-8(13(20)11(16)6-9)7-17-18-14(21)10-3-1-2-4-12(10)19;/h2*1-7,19-20H,(H,18,21);/q;;+2/p-2/b2*17-7+; |
| InChIKey | MXAPWQBGUKNBCH-CNHJQGRJSA-L |
| XLogP | 5.07 |
| TPSA | 169.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.22 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|