C22H16N4O6 — CID 135584409
2-[[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4,6-dinitrophenol (PubChem CID 135584409) has the molecular formula C22H16N4O6 and a molecular weight of 432.39 g/mol. Its IUPAC name is 2-[[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4,6-dinitrophenol.
| Compound Name | 2-[[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 135584409 |
| Molecular Formula | C22H16N4O6 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-[[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4,6-dinitrophenol |
| SMILES | CCc1ccc2oc(-c3ccc(/N=C/c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4O)cc3)nc2c1 |
| InChI | InChI=1S/C22H16N4O6/c1-2-13-3-8-20-18(9-13)24-22(32-20)14-4-6-16(7-5-14)23-12-15-10-17(25(28)29)11-19(21(15)27)26(30)31/h3-12,27H,2H2,1H3/b23-12+ |
| InChIKey | FNPCOJGSNBXWFK-FSJBWODESA-N |
| XLogP | 5.33 |
| TPSA | 144.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|