C23H18N3O6- — CID 135841939
2-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]iminomethyl]-6-methoxy-4-nitrophenolate (PubChem CID 135841939) has the molecular formula C23H18N3O6- and a molecular weight of 432.41 g/mol. Its IUPAC name is 2-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]iminomethyl]-6-methoxy-4-nitrophenolate.
| Compound Name | 2-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]iminomethyl]-6-methoxy-4-nitrophenolate |
|---|---|
| PubChem CID | 135841939 |
| Molecular Formula | C23H18N3O6- |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]iminomethyl]-6-methoxy-4-nitrophenolate |
| SMILES | CCc1ccc2oc(-c3cc(/N=C/c4cc([N+](=O)[O-])cc(OC)c4[O-])ccc3O)nc2c1 |
| InChI | InChI=1S/C23H19N3O6/c1-3-13-4-7-20-18(8-13)25-23(32-20)17-10-15(5-6-19(17)27)24-12-14-9-16(26(29)30)11-21(31-2)22(14)28/h4-12,27-28H,3H2,1-2H3/p-1/b24-12+ |
| InChIKey | RDLZAQROXBLBHH-WYMPLXKRSA-M |
| XLogP | 4.50 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|