C16H12Br2N4O4 — CID 3400767
2-[(5,6-dibromo-1-methylbenzimidazol-2-yl)iminomethyl]-4-methoxy-6-nitrophenol (PubChem CID 3400767) has the molecular formula C16H12Br2N4O4 and a molecular weight of 484.10 g/mol. Its IUPAC name is 2-[(5,6-dibromo-1-methylbenzimidazol-2-yl)iminomethyl]-4-methoxy-6-nitrophenol.
| Compound Name | 2-[(5,6-dibromo-1-methylbenzimidazol-2-yl)iminomethyl]-4-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 3400767 |
| Molecular Formula | C16H12Br2N4O4 |
| Molecular Weight | 484.10 g/mol |
| Exact Mass | 481.92 |
| IUPAC Name | 2-[(5,6-dibromo-1-methylbenzimidazol-2-yl)iminomethyl]-4-methoxy-6-nitrophenol |
| SMILES | COc1cc(C=Nc2nc3cc(Br)c(Br)cc3n2C)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12Br2N4O4/c1-21-13-6-11(18)10(17)5-12(13)20-16(21)19-7-8-3-9(26-2)4-14(15(8)23)22(24)25/h3-7,23H,1-2H3 |
| InChIKey | YLQGHNJVXGUJMX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.10 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|