C12H11N3O5 — CID 2316172
4-methoxy-2-[(5-methyl-1,2-oxazol-3-yl)iminomethyl]-6-nitrophenol (PubChem CID 2316172) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is 4-methoxy-2-[(5-methyl-1,2-oxazol-3-yl)iminomethyl]-6-nitrophenol.
| Compound Name | 4-methoxy-2-[(5-methyl-1,2-oxazol-3-yl)iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 2316172 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-methoxy-2-[(5-methyl-1,2-oxazol-3-yl)iminomethyl]-6-nitrophenol |
| SMILES | COc1cc(/C=N/c2cc(C)on2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11N3O5/c1-7-3-11(14-20-7)13-6-8-4-9(19-2)5-10(12(8)16)15(17)18/h3-6,16H,1-2H3/b13-6+ |
| InChIKey | UPWNYPPWETUWDT-AWNIVKPZSA-N |
| XLogP | 2.36 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|