C23H24BrN3O4 — CID 126253070
5-bromo-7-methoxy-N-[(Z)-(2-methoxy-4-piperidin-1-ylphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126253070) has the molecular formula C23H24BrN3O4 and a molecular weight of 486.37 g/mol. Its IUPAC name is 5-bromo-7-methoxy-N-[(Z)-(2-methoxy-4-piperidin-1-ylphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-7-methoxy-N-[(Z)-(2-methoxy-4-piperidin-1-ylphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126253070 |
| Molecular Formula | C23H24BrN3O4 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 5-bromo-7-methoxy-N-[(Z)-(2-methoxy-4-piperidin-1-ylphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(N2CCCCC2)ccc1/C=N\NC(=O)c1cc2cc(Br)cc(OC)c2o1 |
| InChI | InChI=1S/C23H24BrN3O4/c1-29-19-13-18(27-8-4-3-5-9-27)7-6-15(19)14-25-26-23(28)21-11-16-10-17(24)12-20(30-2)22(16)31-21/h6-7,10-14H,3-5,8-9H2,1-2H3,(H,26,28)/b25-14- |
| InChIKey | KSALEZISFUNAHL-QFEZKATASA-N |
| XLogP | 4.97 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|