C19H25N3O4 — CID 96874001
(4S)-N-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide (PubChem CID 96874001) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (4S)-N-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide.
| Compound Name | (4S)-N-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 96874001 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (4S)-N-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide |
| SMILES | CCOc1ccc([C@@H](O)CCC(=O)N/N=C\c2ccc(N(C)C)o2)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-4-25-15-7-5-14(6-8-15)17(23)10-11-18(24)21-20-13-16-9-12-19(26-16)22(2)3/h5-9,12-13,17,23H,4,10-11H2,1-3H3,(H,21,24)/b20-13-/t17-/m0/s1 |
| InChIKey | OSIZXSRBOIMRDT-IZQLPPHKSA-N |
| XLogP | 2.71 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_A(15)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|