C15H15IN2O3 — CID 94833727
(4R)-4-hydroxy-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4-phenylbutanamide (PubChem CID 94833727) has the molecular formula C15H15IN2O3 and a molecular weight of 398.20 g/mol. Its IUPAC name is (4R)-4-hydroxy-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4-phenylbutanamide.
| Compound Name | (4R)-4-hydroxy-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 94833727 |
| Molecular Formula | C15H15IN2O3 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | (4R)-4-hydroxy-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4-phenylbutanamide |
| SMILES | O=C(CC[C@@H](O)c1ccccc1)N/N=C\c1ccc(I)o1 |
| InChI | InChI=1S/C15H15IN2O3/c16-14-8-6-12(21-14)10-17-18-15(20)9-7-13(19)11-4-2-1-3-5-11/h1-6,8,10,13,19H,7,9H2,(H,18,20)/b17-10-/t13-/m1/s1 |
| InChIKey | UGIAYHGUJXMIGO-OMJMQIJPSA-N |
| XLogP | 2.85 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|