C12H16IN3O3 — CID 5439570
N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-3-morpholin-4-ylpropanamide (PubChem CID 5439570) has the molecular formula C12H16IN3O3 and a molecular weight of 377.18 g/mol. Its IUPAC name is N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 5439570 |
| Molecular Formula | C12H16IN3O3 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-3-morpholin-4-ylpropanamide |
| SMILES | O=C(CCN1CCOCC1)N/N=C\c1ccc(I)o1 |
| InChI | InChI=1S/C12H16IN3O3/c13-11-2-1-10(19-11)9-14-15-12(17)3-4-16-5-7-18-8-6-16/h1-2,9H,3-8H2,(H,15,17)/b14-9- |
| InChIKey | MDLADGHEYWDLGZ-ZROIWOOFSA-N |
| XLogP | 1.06 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|