C13H10I2N4O4 — CID 44791034
N,N'-bis[(E)-(5-iodofuran-2-yl)methylideneamino]propanediamide (PubChem CID 44791034) has the molecular formula C13H10I2N4O4 and a molecular weight of 540.06 g/mol. Its IUPAC name is N,N'-bis[(E)-(5-iodofuran-2-yl)methylideneamino]propanediamide.
| Compound Name | N,N'-bis[(E)-(5-iodofuran-2-yl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 44791034 |
| Molecular Formula | C13H10I2N4O4 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.88 |
| IUPAC Name | N,N'-bis[(E)-(5-iodofuran-2-yl)methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)N/N=C/c1ccc(I)o1)N/N=C/c1ccc(I)o1 |
| InChI | InChI=1S/C13H10I2N4O4/c14-10-3-1-8(22-10)6-16-18-12(20)5-13(21)19-17-7-9-2-4-11(15)23-9/h1-4,6-7H,5H2,(H,18,20)(H,19,21)/b16-6+,17-7+ |
| InChIKey | CUXBFWLPYXOEFS-KGMKFKQSSA-N |
| XLogP | 2.07 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|