C28H28FN3O3 — CID 96874191
(4S)-4-(4-ethoxyphenyl)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-4-hydroxybutanamide (PubChem CID 96874191) has the molecular formula C28H28FN3O3 and a molecular weight of 473.55 g/mol. Its IUPAC name is (4S)-4-(4-ethoxyphenyl)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-4-hydroxybutanamide.
| Compound Name | (4S)-4-(4-ethoxyphenyl)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-4-hydroxybutanamide |
|---|---|
| PubChem CID | 96874191 |
| Molecular Formula | C28H28FN3O3 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (4S)-4-(4-ethoxyphenyl)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-4-hydroxybutanamide |
| SMILES | CCOc1ccc([C@@H](O)CCC(=O)N/N=C\c2cn(Cc3ccc(F)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H28FN3O3/c1-2-35-24-13-9-21(10-14-24)27(33)15-16-28(34)31-30-17-22-19-32(26-6-4-3-5-25(22)26)18-20-7-11-23(29)12-8-20/h3-14,17,19,27,33H,2,15-16,18H2,1H3,(H,31,34)/b30-17-/t27-/m0/s1 |
| InChIKey | APJNSVATBYRCSE-FNJJVTQMSA-N |
| XLogP | 5.19 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|