C25H22Cl3N3O3 — CID 126170329
N'-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-N-(3,4-dichlorophenyl)pentanediamide (PubChem CID 126170329) has the molecular formula C25H22Cl3N3O3 and a molecular weight of 518.83 g/mol. Its IUPAC name is N'-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-N-(3,4-dichlorophenyl)pentanediamide.
| Compound Name | N'-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-N-(3,4-dichlorophenyl)pentanediamide |
|---|---|
| PubChem CID | 126170329 |
| Molecular Formula | C25H22Cl3N3O3 |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | N'-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-N-(3,4-dichlorophenyl)pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccc(Cl)c(Cl)c1)N/N=C\c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H22Cl3N3O3/c26-19-8-4-18(5-9-19)16-34-21-11-6-17(7-12-21)15-29-31-25(33)3-1-2-24(32)30-20-10-13-22(27)23(28)14-20/h4-15H,1-3,16H2,(H,30,32)(H,31,33)/b29-15- |
| InChIKey | BTCFPTRCSJRNGV-FDVSRXAVSA-N |
| XLogP | 6.48 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|