C25H23Cl2N3O3 — CID 6871476
N-(4-chlorophenyl)-N'-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]pentanediamide (PubChem CID 6871476) has the molecular formula C25H23Cl2N3O3 and a molecular weight of 484.38 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]pentanediamide.
| Compound Name | N-(4-chlorophenyl)-N'-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 6871476 |
| Molecular Formula | C25H23Cl2N3O3 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | N-(4-chlorophenyl)-N'-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccc(Cl)cc1)N/N=C/c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H23Cl2N3O3/c26-20-10-12-21(13-11-20)29-24(31)6-3-7-25(32)30-28-16-18-8-14-22(15-9-18)33-17-19-4-1-2-5-23(19)27/h1-2,4-5,8-16H,3,6-7,17H2,(H,29,31)(H,30,32)/b28-16+ |
| InChIKey | NXUMIDVZURWWKX-LQKURTRISA-N |
| XLogP | 5.83 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|