C25H22BrCl2N3O3 — CID 126159543
N-(4-bromophenyl)-N'-[(Z)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]pentanediamide (PubChem CID 126159543) has the molecular formula C25H22BrCl2N3O3 and a molecular weight of 563.28 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[(Z)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]pentanediamide.
| Compound Name | N-(4-bromophenyl)-N'-[(Z)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 126159543 |
| Molecular Formula | C25H22BrCl2N3O3 |
| Molecular Weight | 563.28 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | N-(4-bromophenyl)-N'-[(Z)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccc(Br)cc1)N/N=C\c1cccc(OCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H22BrCl2N3O3/c26-19-8-10-20(11-9-19)30-24(32)5-2-6-25(33)31-29-15-17-3-1-4-21(13-17)34-16-18-7-12-22(27)23(28)14-18/h1,3-4,7-15H,2,5-6,16H2,(H,30,32)(H,31,33)/b29-15- |
| InChIKey | MJWQEKJGPYFSNI-FDVSRXAVSA-N |
| XLogP | 6.59 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.28 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|