C15H13Cl2N3OS — CID 110340789
[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]thiourea (PubChem CID 110340789) has the molecular formula C15H13Cl2N3OS and a molecular weight of 354.26 g/mol. Its IUPAC name is [(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | [(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 110340789 |
| Molecular Formula | C15H13Cl2N3OS |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | [(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1cccc(OCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H13Cl2N3OS/c16-13-5-4-11(7-14(13)17)9-21-12-3-1-2-10(6-12)8-19-20-15(18)22/h1-8H,9H2,(H3,18,20,22)/b19-8+ |
| InChIKey | NPXJXAORGNEKGB-UFWORHAWSA-N |
| XLogP | 3.74 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|