C14H13N3O4S — CID 168535569
5-[[3-[(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 168535569) has the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. Its IUPAC name is 5-[[3-[(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-[(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 168535569 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 5-[[3-[(carbamothioylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | NC(=S)NN=Cc1cccc(OCc2ccc(C(=O)O)o2)c1 |
| InChI | InChI=1S/C14H13N3O4S/c15-14(22)17-16-7-9-2-1-3-10(6-9)20-8-11-4-5-12(21-11)13(18)19/h1-7H,8H2,(H,18,19)(H3,15,17,22) |
| InChIKey | WEVRYFNNTPAVDA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|