C23H26BrN3O6 — CID 5233149
methyl 2-[2-bromo-4-[[[3-(2,4-dimethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate (PubChem CID 5233149) has the molecular formula C23H26BrN3O6 and a molecular weight of 520.38 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[[[3-(2,4-dimethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[[[3-(2,4-dimethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 5233149 |
| Molecular Formula | C23H26BrN3O6 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | methyl 2-[2-bromo-4-[[[3-(2,4-dimethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=NNC(=O)CC(=O)Nc2ccc(C)cc2C)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C23H26BrN3O6/c1-5-32-19-10-16(9-17(24)23(19)33-13-22(30)31-4)12-25-27-21(29)11-20(28)26-18-7-6-14(2)8-15(18)3/h6-10,12H,5,11,13H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | VYUPZJSZGGNLSG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|