C18H18BrN3O4 — CID 3297181
N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide (PubChem CID 3297181) has the molecular formula C18H18BrN3O4 and a molecular weight of 420.26 g/mol. Its IUPAC name is N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide.
| Compound Name | N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 3297181 |
| Molecular Formula | C18H18BrN3O4 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide |
| SMILES | CCOc1ccc(NC(=O)CC(=O)NN=Cc2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C18H18BrN3O4/c1-2-26-15-6-4-14(5-7-15)21-17(24)10-18(25)22-20-11-12-9-13(19)3-8-16(12)23/h3-9,11,23H,2,10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | MXQLDRKKRWOBGJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|