C24H21ClI2N2O4 — CID 126365218
N-[(E)-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 126365218) has the molecular formula C24H21ClI2N2O4 and a molecular weight of 690.70 g/mol. Its IUPAC name is N-[(E)-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126365218 |
| Molecular Formula | C24H21ClI2N2O4 |
| Molecular Weight | 690.70 g/mol |
| Exact Mass | 689.93 |
| IUPAC Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C/c2cc(I)c(OCc3ccc(Cl)cc3)c(I)c2)cc1OC |
| InChI | InChI=1S/C24H21ClI2N2O4/c1-31-21-8-5-16(11-22(21)32-2)12-23(30)29-28-13-17-9-19(26)24(20(27)10-17)33-14-15-3-6-18(25)7-4-15/h3-11,13H,12,14H2,1-2H3,(H,29,30)/b28-13+ |
| InChIKey | DDKYUVSHRMZHOX-XODNFHPESA-N |
| XLogP | 5.84 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|