C25H24ClIN2O3 — CID 124559177
N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-(3,4-dimethylphenyl)acetamide (PubChem CID 124559177) has the molecular formula C25H24ClIN2O3 and a molecular weight of 562.84 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-(3,4-dimethylphenyl)acetamide.
| Compound Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 124559177 |
| Molecular Formula | C25H24ClIN2O3 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-(3,4-dimethylphenyl)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2ccc(C)c(C)c2)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C25H24ClIN2O3/c1-16-8-9-18(10-17(16)2)13-24(30)29-28-14-19-11-22(27)25(23(12-19)31-3)32-15-20-6-4-5-7-21(20)26/h4-12,14H,13,15H2,1-3H3,(H,29,30)/b28-14- |
| InChIKey | SATHUTRELNDGHC-MUXKCCDJSA-N |
| XLogP | 5.84 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|