C24H22ClI2N3O3 — CID 126049956
N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-iodoanilino)acetamide (PubChem CID 126049956) has the molecular formula C24H22ClI2N3O3 and a molecular weight of 689.72 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-iodoanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-iodoanilino)acetamide |
|---|---|
| PubChem CID | 126049956 |
| Molecular Formula | C24H22ClI2N3O3 |
| Molecular Weight | 689.72 g/mol |
| Exact Mass | 688.94 |
| IUPAC Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-iodoanilino)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNc2ccc(I)cc2)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H22ClI2N3O3/c1-2-32-22-12-16(11-21(27)24(22)33-15-17-5-3-4-6-20(17)25)13-29-30-23(31)14-28-19-9-7-18(26)8-10-19/h3-13,28H,2,14-15H2,1H3,(H,30,31)/b29-13- |
| InChIKey | ROZMDNLLDOTDTR-DBFSUHOCSA-N |
| XLogP | 6.09 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.72 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|